C21H26N2O3S2 — CID 10159013
(E)-3-cyclooctyl-2-(4-methylsulfonylphenyl)-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 10159013) has the molecular formula C21H26N2O3S2 and a molecular weight of 418.58 g/mol. Its IUPAC name is (E)-3-cyclooctyl-2-(4-methylsulfonylphenyl)-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-cyclooctyl-2-(4-methylsulfonylphenyl)-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 10159013 |
| Molecular Formula | C21H26N2O3S2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (E)-3-cyclooctyl-2-(4-methylsulfonylphenyl)-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1ccc(/C(=C\C2CCCCCCC2)C(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C21H26N2O3S2/c1-28(25,26)18-11-9-17(10-12-18)19(20(24)23-21-22-13-14-27-21)15-16-7-5-3-2-4-6-8-16/h9-16H,2-8H2,1H3,(H,22,23,24)/b19-15+ |
| InChIKey | FAGVPXDHYNJFCC-XDJHFCHBSA-N |
| XLogP | 4.93 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|