C27H27N5O2 — CID 10161278
4-benzhydryl-N-(3-methoxyquinoxalin-2-yl)piperazine-1-carboxamide (PubChem CID 10161278) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is 4-benzhydryl-N-(3-methoxyquinoxalin-2-yl)piperazine-1-carboxamide.
| Compound Name | 4-benzhydryl-N-(3-methoxyquinoxalin-2-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 10161278 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 4-benzhydryl-N-(3-methoxyquinoxalin-2-yl)piperazine-1-carboxamide |
| SMILES | COc1nc2ccccc2nc1NC(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H27N5O2/c1-34-26-25(28-22-14-8-9-15-23(22)29-26)30-27(33)32-18-16-31(17-19-32)24(20-10-4-2-5-11-20)21-12-6-3-7-13-21/h2-15,24H,16-19H2,1H3,(H,28,30,33) |
| InChIKey | FFWZNLWHGIKRTJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |