C19H33NNa2O5 — CID 101614236
disodium;(4S)-5-hydroxy-4-(1-oxidotetradecylideneamino)-5-oxopentanoate (PubChem CID 101614236) has the molecular formula C19H33NNa2O5 and a molecular weight of 401.40 g/mol. Its IUPAC name is disodium;(4S)-5-hydroxy-4-(1-oxidotetradecylideneamino)-5-oxopentanoate.
| Compound Name | disodium;(4S)-5-hydroxy-4-(1-oxidotetradecylideneamino)-5-oxopentanoate |
|---|---|
| PubChem CID | 101614236 |
| Molecular Formula | C19H33NNa2O5 |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | disodium;(4S)-5-hydroxy-4-(1-oxidotetradecylideneamino)-5-oxopentanoate |
| SMILES | CCCCCCCCCCCCCC(=N[C@@H](CCC(=O)[O-])C(=O)O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C19H35NO5.2Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(21)20-16(19(24)25)14-15-18(22)23;;/h16H,2-15H2,1H3,(H,20,21)(H,22,23)(H,24,25);;/q;2*+1/p-2/t16-;;/m0../s1 |
| InChIKey | SXBBFOVRSQCYFE-SQKCAUCHSA-L |
| XLogP | — |
| TPSA | 113.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | 390 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|