C25H22F3N5O — CID 10161980
2-anilino-1-phenyl-7-piperazin-1-yl-5-(trifluoromethyl)-1,8-naphthyridin-4-one (PubChem CID 10161980) has the molecular formula C25H22F3N5O and a molecular weight of 465.48 g/mol. Its IUPAC name is 2-anilino-1-phenyl-7-piperazin-1-yl-5-(trifluoromethyl)-1,8-naphthyridin-4-one.
| Compound Name | 2-anilino-1-phenyl-7-piperazin-1-yl-5-(trifluoromethyl)-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 10161980 |
| Molecular Formula | C25H22F3N5O |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 2-anilino-1-phenyl-7-piperazin-1-yl-5-(trifluoromethyl)-1,8-naphthyridin-4-one |
| SMILES | O=c1cc(Nc2ccccc2)n(-c2ccccc2)c2nc(N3CCNCC3)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C25H22F3N5O/c26-25(27,28)19-15-21(32-13-11-29-12-14-32)31-24-23(19)20(34)16-22(30-17-7-3-1-4-8-17)33(24)18-9-5-2-6-10-18/h1-10,15-16,29-30H,11-14H2 |
| InChIKey | UYUPCWPWXXXEDL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |