C29H36N4O2 — CID 10162397
tert-butyl 4-[2-[[4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenyl]methylamino]ethyl]piperidine-1-carboxylate (PubChem CID 10162397) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is tert-butyl 4-[2-[[4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenyl]methylamino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenyl]methylamino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10162397 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | tert-butyl 4-[2-[[4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenyl]methylamino]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCNCc2ccc(-c3n[nH]c4c3Cc3ccccc3-4)cc2)CC1 |
| InChI | InChI=1S/C29H36N4O2/c1-29(2,3)35-28(34)33-16-13-20(14-17-33)12-15-30-19-21-8-10-22(11-9-21)26-25-18-23-6-4-5-7-24(23)27(25)32-31-26/h4-11,20,30H,12-19H2,1-3H3,(H,31,32) |
| InChIKey | YPXYJPVQVUYOQB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|