C20H15ClF3NO2 — CID 1016317
3-[1-[4-chloro-3-(trifluoromethyl)phenyl]-5-phenylpyrrol-2-yl]propanoic acid (PubChem CID 1016317) has the molecular formula C20H15ClF3NO2 and a molecular weight of 393.79 g/mol. Its IUPAC name is 3-[1-[4-chloro-3-(trifluoromethyl)phenyl]-5-phenylpyrrol-2-yl]propanoic acid.
| Compound Name | 3-[1-[4-chloro-3-(trifluoromethyl)phenyl]-5-phenylpyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 1016317 |
| Molecular Formula | C20H15ClF3NO2 |
| Molecular Weight | 393.79 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 3-[1-[4-chloro-3-(trifluoromethyl)phenyl]-5-phenylpyrrol-2-yl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(-c2ccccc2)n1-c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H15ClF3NO2/c21-17-9-6-15(12-16(17)20(22,23)24)25-14(8-11-19(26)27)7-10-18(25)13-4-2-1-3-5-13/h1-7,9-10,12H,8,11H2,(H,26,27) |
| InChIKey | XOKRNWGMHPTGCF-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.79 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|