C24H36NO2+ — CID 10163796
3,3-bis(2-methoxyphenyl)propyl-methyl-di(propan-2-yl)azanium (PubChem CID 10163796) has the molecular formula C24H36NO2+ and a molecular weight of 370.56 g/mol. Its IUPAC name is 3,3-bis(2-methoxyphenyl)propyl-methyl-di(propan-2-yl)azanium.
| Compound Name | 3,3-bis(2-methoxyphenyl)propyl-methyl-di(propan-2-yl)azanium |
|---|---|
| PubChem CID | 10163796 |
| Molecular Formula | C24H36NO2+ |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | 3,3-bis(2-methoxyphenyl)propyl-methyl-di(propan-2-yl)azanium |
| SMILES | COc1ccccc1C(CC[N+](C)(C(C)C)C(C)C)c1ccccc1OC |
| InChI | InChI=1S/C24H36NO2/c1-18(2)25(5,19(3)4)17-16-20(21-12-8-10-14-23(21)26-6)22-13-9-11-15-24(22)27-7/h8-15,18-20H,16-17H2,1-7H3/q+1 |
| InChIKey | AIWHVYSXHUYYRQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|