C17H19BrO — CID 58302960
1-bromo-4-[1-(2-methoxyphenyl)butyl]benzene (PubChem CID 58302960) has the molecular formula C17H19BrO and a molecular weight of 319.24 g/mol. Its IUPAC name is 1-bromo-4-[1-(2-methoxyphenyl)butyl]benzene.
| Compound Name | 1-bromo-4-[1-(2-methoxyphenyl)butyl]benzene |
|---|---|
| PubChem CID | 58302960 |
| Molecular Formula | C17H19BrO |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-bromo-4-[1-(2-methoxyphenyl)butyl]benzene |
| SMILES | CCCC(c1ccc(Br)cc1)c1ccccc1OC |
| InChI | InChI=1S/C17H19BrO/c1-3-6-15(13-9-11-14(18)12-10-13)16-7-4-5-8-17(16)19-2/h4-5,7-12,15H,3,6H2,1-2H3 |
| InChIKey | XKMYFTZGOIVFSD-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |