C30H31Br2N — CID 70441708
1-(4-bromophenyl)-N-[(4-bromophenyl)methyl]methanamine;1-phenylbutylbenzene (PubChem CID 70441708) has the molecular formula C30H31Br2N and a molecular weight of 565.39 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[(4-bromophenyl)methyl]methanamine;1-phenylbutylbenzene.
| Compound Name | 1-(4-bromophenyl)-N-[(4-bromophenyl)methyl]methanamine;1-phenylbutylbenzene |
|---|---|
| PubChem CID | 70441708 |
| Molecular Formula | C30H31Br2N |
| Molecular Weight | 565.39 g/mol |
| Exact Mass | 563.08 |
| IUPAC Name | 1-(4-bromophenyl)-N-[(4-bromophenyl)methyl]methanamine;1-phenylbutylbenzene |
| SMILES | Brc1ccc(CNCc2ccc(Br)cc2)cc1.CCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H18.C14H13Br2N/c1-2-9-16(14-10-5-3-6-11-14)15-12-7-4-8-13-15;15-13-5-1-11(2-6-13)9-17-10-12-3-7-14(16)8-4-12/h3-8,10-13,16H,2,9H2,1H3;1-8,17H,9-10H2 |
| InChIKey | ADUHNSSWKGKQBT-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.39 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |