C20H15F7N2O4S — CID 10164582
1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-2,2,2-trifluoroethanol (PubChem CID 10164582) has the molecular formula C20H15F7N2O4S and a molecular weight of 512.40 g/mol. Its IUPAC name is 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-2,2,2-trifluoroethanol.
| Compound Name | 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 10164582 |
| Molecular Formula | C20H15F7N2O4S |
| Molecular Weight | 512.40 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | 1-[5-[1-[3,4-bis(difluoromethoxy)phenyl]-2-(1-oxidopyridin-1-ium-4-yl)ethyl]-1,3-thiazol-2-yl]-2,2,2-trifluoroethanol |
| SMILES | [O-][n+]1ccc(CC(c2ccc(OC(F)F)c(OC(F)F)c2)c2cnc(C(O)C(F)(F)F)s2)cc1 |
| InChI | InChI=1S/C20H15F7N2O4S/c21-18(22)32-13-2-1-11(8-14(13)33-19(23)24)12(7-10-3-5-29(31)6-4-10)15-9-28-17(34-15)16(30)20(25,26)27/h1-6,8-9,12,16,18-19,30H,7H2 |
| InChIKey | ZOYIHIBRRYWBTE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.40 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|