C25H20F3N3O5S — CID 10165420
4-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-6-(trifluoromethyl)quinoline-3-carboxamide (PubChem CID 10165420) has the molecular formula C25H20F3N3O5S and a molecular weight of 531.51 g/mol. Its IUPAC name is 4-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-6-(trifluoromethyl)quinoline-3-carboxamide.
| Compound Name | 4-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-6-(trifluoromethyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 10165420 |
| Molecular Formula | C25H20F3N3O5S |
| Molecular Weight | 531.51 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | 4-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-6-(trifluoromethyl)quinoline-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)c2c(C(=O)NO)cnc3ccc(C(F)(F)F)cc23)cc1 |
| InChI | InChI=1S/C25H20F3N3O5S/c1-36-18-8-10-19(11-9-18)37(34,35)31(15-16-5-3-2-4-6-16)23-20-13-17(25(26,27)28)7-12-22(20)29-14-21(23)24(32)30-33/h2-14,33H,15H2,1H3,(H,30,32) |
| InChIKey | BYFPJSOGSJVRJE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|