C22H29Cl4N5O2 — CID 10165648
(2S)-1-[(2R)-2-amino-3-(3,4-dichlorophenyl)propanoyl]-N-(4,5,6,7-tetrahydro-1H-indazol-5-ylmethyl)pyrrolidine-2-carboxamide;dihydrochloride (PubChem CID 10165648) has the molecular formula C22H29Cl4N5O2 and a molecular weight of 537.32 g/mol. Its IUPAC name is (2S)-1-[(2R)-2-amino-3-(3,4-dichlorophenyl)propanoyl]-N-(4,5,6,7-tetrahydro-1H-indazol-5-ylmethyl)pyrrolidine-2-carboxamide;dihydrochloride.
| Compound Name | (2S)-1-[(2R)-2-amino-3-(3,4-dichlorophenyl)propanoyl]-N-(4,5,6,7-tetrahydro-1H-indazol-5-ylmethyl)pyrrolidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 10165648 |
| Molecular Formula | C22H29Cl4N5O2 |
| Molecular Weight | 537.32 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | (2S)-1-[(2R)-2-amino-3-(3,4-dichlorophenyl)propanoyl]-N-(4,5,6,7-tetrahydro-1H-indazol-5-ylmethyl)pyrrolidine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.N[C@H](Cc1ccc(Cl)c(Cl)c1)C(=O)N1CCC[C@H]1C(=O)NCC1CCc2[nH]ncc2C1 |
| InChI | InChI=1S/C22H27Cl2N5O2.2ClH/c23-16-5-3-13(9-17(16)24)10-18(25)22(31)29-7-1-2-20(29)21(30)26-11-14-4-6-19-15(8-14)12-27-28-19;;/h3,5,9,12,14,18,20H,1-2,4,6-8,10-11,25H2,(H,26,30)(H,27,28);2*1H/t14?,18-,20+;;/m1../s1 |
| InChIKey | GEIBGVIEQGLASX-URTRBSDVSA-N |
| XLogP | 3.34 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |