C26H22ClN5 — CID 10166743
4-chloro-N'-[(1R)-2-(1H-indol-3-yl)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]benzenecarboximidamide (PubChem CID 10166743) has the molecular formula C26H22ClN5 and a molecular weight of 439.95 g/mol. Its IUPAC name is 4-chloro-N'-[(1R)-2-(1H-indol-3-yl)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]benzenecarboximidamide.
| Compound Name | 4-chloro-N'-[(1R)-2-(1H-indol-3-yl)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 10166743 |
| Molecular Formula | C26H22ClN5 |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 4-chloro-N'-[(1R)-2-(1H-indol-3-yl)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]benzenecarboximidamide |
| SMILES | N/C(=N\[C@H](Cc1c[nH]c2ccccc12)c1ncc(-c2ccccc2)[nH]1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H22ClN5/c27-20-12-10-18(11-13-20)25(28)31-23(14-19-15-29-22-9-5-4-8-21(19)22)26-30-16-24(32-26)17-6-2-1-3-7-17/h1-13,15-16,23,29H,14H2,(H2,28,31)(H,30,32)/t23-/m1/s1 |
| InChIKey | UEBYNWAHMKBMAT-HSZRJFAPSA-N |
| XLogP | 5.90 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|