C13H10ClN3 — CID 6538792
6-(4-chlorophenyl)-7-methyl-5H-pyrrolo[2,3-b]pyrazine (PubChem CID 6538792) has the molecular formula C13H10ClN3 and a molecular weight of 243.70 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-7-methyl-5H-pyrrolo[2,3-b]pyrazine.
| Compound Name | 6-(4-chlorophenyl)-7-methyl-5H-pyrrolo[2,3-b]pyrazine |
|---|---|
| PubChem CID | 6538792 |
| Molecular Formula | C13H10ClN3 |
| Molecular Weight | 243.70 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 6-(4-chlorophenyl)-7-methyl-5H-pyrrolo[2,3-b]pyrazine |
| SMILES | Cc1c(-c2ccc(Cl)cc2)[nH]c2nccnc12 |
| InChI | InChI=1S/C13H10ClN3/c1-8-11(9-2-4-10(14)5-3-9)17-13-12(8)15-6-7-16-13/h2-7H,1H3,(H,16,17) |
| InChIKey | SZRBJCSOUDDITM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.70 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |