C21H15ClIN5O2S — CID 1016818
N-[[2-(3-chloro-4-methoxyphenyl)benzotriazol-5-yl]carbamothioyl]-2-iodobenzamide (PubChem CID 1016818) has the molecular formula C21H15ClIN5O2S and a molecular weight of 563.81 g/mol. Its IUPAC name is N-[[2-(3-chloro-4-methoxyphenyl)benzotriazol-5-yl]carbamothioyl]-2-iodobenzamide.
| Compound Name | N-[[2-(3-chloro-4-methoxyphenyl)benzotriazol-5-yl]carbamothioyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 1016818 |
| Molecular Formula | C21H15ClIN5O2S |
| Molecular Weight | 563.81 g/mol |
| Exact Mass | 562.97 |
| IUPAC Name | N-[[2-(3-chloro-4-methoxyphenyl)benzotriazol-5-yl]carbamothioyl]-2-iodobenzamide |
| SMILES | COc1ccc(-n2nc3ccc(NC(=S)NC(=O)c4ccccc4I)cc3n2)cc1Cl |
| InChI | InChI=1S/C21H15ClIN5O2S/c1-30-19-9-7-13(11-15(19)22)28-26-17-8-6-12(10-18(17)27-28)24-21(31)25-20(29)14-4-2-3-5-16(14)23/h2-11H,1H3,(H2,24,25,29,31) |
| InChIKey | VKYQZADPJFHYOR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.81 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|