C25H24ClN5O3S — CID 3645366
4-butan-2-yloxy-N-[[2-(3-chloro-4-methoxyphenyl)benzotriazol-5-yl]carbamothioyl]benzamide (PubChem CID 3645366) has the molecular formula C25H24ClN5O3S and a molecular weight of 510.02 g/mol. Its IUPAC name is 4-butan-2-yloxy-N-[[2-(3-chloro-4-methoxyphenyl)benzotriazol-5-yl]carbamothioyl]benzamide.
| Compound Name | 4-butan-2-yloxy-N-[[2-(3-chloro-4-methoxyphenyl)benzotriazol-5-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3645366 |
| Molecular Formula | C25H24ClN5O3S |
| Molecular Weight | 510.02 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 4-butan-2-yloxy-N-[[2-(3-chloro-4-methoxyphenyl)benzotriazol-5-yl]carbamothioyl]benzamide |
| SMILES | CCC(C)Oc1ccc(C(=O)NC(=S)Nc2ccc3nn(-c4ccc(OC)c(Cl)c4)nc3c2)cc1 |
| InChI | InChI=1S/C25H24ClN5O3S/c1-4-15(2)34-19-9-5-16(6-10-19)24(32)28-25(35)27-17-7-11-21-22(13-17)30-31(29-21)18-8-12-23(33-3)20(26)14-18/h5-15H,4H2,1-3H3,(H2,27,28,32,35) |
| InChIKey | KDRLDQXJJPCZCE-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.02 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|