C37H39F3N6O3 — CID 10168700
4-[(1H-imidazol-2-ylmethylamino)methyl]-N-[(2S)-1-(1-naphthalen-1-ylethylamino)-1-oxo-5-[[2-(trifluoromethoxy)phenyl]methylamino]pentan-2-yl]benzamide (PubChem CID 10168700) has the molecular formula C37H39F3N6O3 and a molecular weight of 672.75 g/mol. Its IUPAC name is 4-[(1H-imidazol-2-ylmethylamino)methyl]-N-[(2S)-1-(1-naphthalen-1-ylethylamino)-1-oxo-5-[[2-(trifluoromethoxy)phenyl]methylamino]pentan-2-yl]benzamide.
| Compound Name | 4-[(1H-imidazol-2-ylmethylamino)methyl]-N-[(2S)-1-(1-naphthalen-1-ylethylamino)-1-oxo-5-[[2-(trifluoromethoxy)phenyl]methylamino]pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 10168700 |
| Molecular Formula | C37H39F3N6O3 |
| Molecular Weight | 672.75 g/mol |
| Exact Mass | 672.30 |
| IUPAC Name | 4-[(1H-imidazol-2-ylmethylamino)methyl]-N-[(2S)-1-(1-naphthalen-1-ylethylamino)-1-oxo-5-[[2-(trifluoromethoxy)phenyl]methylamino]pentan-2-yl]benzamide |
| SMILES | CC(NC(=O)[C@H](CCCNCc1ccccc1OC(F)(F)F)NC(=O)c1ccc(CNCc2ncc[nH]2)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C37H39F3N6O3/c1-25(30-12-6-10-27-8-2-4-11-31(27)30)45-36(48)32(13-7-19-41-23-29-9-3-5-14-33(29)49-37(38,39)40)46-35(47)28-17-15-26(16-18-28)22-42-24-34-43-20-21-44-34/h2-6,8-12,14-18,20-21,25,32,41-42H,7,13,19,22-24H2,1H3,(H,43,44)(H,45,48)(H,46,47)/t25?,32-/m0/s1 |
| InChIKey | MCTAFWAYQANKCT-WYYRYWFOSA-N |
| XLogP | 6.30 |
| TPSA | 120.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.75 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|