C23H43O20P3 — CID 10169213
[3-[(2-acetyloxy-3,6-dihydroxy-4,5-diphosphonooxycyclohexyl)oxy-hydroxyphosphoryl]oxy-2-hexanoyloxypropyl] hexanoate (PubChem CID 10169213) has the molecular formula C23H43O20P3 and a molecular weight of 732.50 g/mol. Its IUPAC name is [3-[(2-acetyloxy-3,6-dihydroxy-4,5-diphosphonooxycyclohexyl)oxy-hydroxyphosphoryl]oxy-2-hexanoyloxypropyl] hexanoate.
| Compound Name | [3-[(2-acetyloxy-3,6-dihydroxy-4,5-diphosphonooxycyclohexyl)oxy-hydroxyphosphoryl]oxy-2-hexanoyloxypropyl] hexanoate |
|---|---|
| PubChem CID | 10169213 |
| Molecular Formula | C23H43O20P3 |
| Molecular Weight | 732.50 g/mol |
| Exact Mass | 732.16 |
| IUPAC Name | [3-[(2-acetyloxy-3,6-dihydroxy-4,5-diphosphonooxycyclohexyl)oxy-hydroxyphosphoryl]oxy-2-hexanoyloxypropyl] hexanoate |
| SMILES | CCCCCC(=O)OCC(COP(=O)(O)OC1C(O)C(OP(=O)(O)O)C(OP(=O)(O)O)C(O)C1OC(C)=O)OC(=O)CCCCC |
| InChI | InChI=1S/C23H43O20P3/c1-4-6-8-10-16(25)37-12-15(40-17(26)11-9-7-5-2)13-38-46(35,36)43-21-19(28)23(42-45(32,33)34)22(41-44(29,30)31)18(27)20(21)39-14(3)24/h15,18-23,27-28H,4-13H2,1-3H3,(H,35,36)(H2,29,30,31)(H2,32,33,34) |
| InChIKey | RJKLCSDCQXEUTD-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 308.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.50 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|