C16H15N3O2 — CID 10171624
N-(2-azabicyclo[2.2.1]heptan-5-yl)-2-cyano-1-benzofuran-6-carboxamide (PubChem CID 10171624) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is N-(2-azabicyclo[2.2.1]heptan-5-yl)-2-cyano-1-benzofuran-6-carboxamide.
| Compound Name | N-(2-azabicyclo[2.2.1]heptan-5-yl)-2-cyano-1-benzofuran-6-carboxamide |
|---|---|
| PubChem CID | 10171624 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-(2-azabicyclo[2.2.1]heptan-5-yl)-2-cyano-1-benzofuran-6-carboxamide |
| SMILES | N#Cc1cc2ccc(C(=O)NC3CC4CC3CN4)cc2o1 |
| InChI | InChI=1S/C16H15N3O2/c17-7-13-4-9-1-2-10(5-15(9)21-13)16(20)19-14-6-12-3-11(14)8-18-12/h1-2,4-5,11-12,14,18H,3,6,8H2,(H,19,20) |
| InChIKey | PMFCDANZZUVKJX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |