C19H18N2O4 — CID 91423741
methyl 3-[6-[[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]carbamoyl]-1-benzofuran-2-yl]prop-2-ynoate (PubChem CID 91423741) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is methyl 3-[6-[[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]carbamoyl]-1-benzofuran-2-yl]prop-2-ynoate.
| Compound Name | methyl 3-[6-[[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]carbamoyl]-1-benzofuran-2-yl]prop-2-ynoate |
|---|---|
| PubChem CID | 91423741 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | methyl 3-[6-[[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]carbamoyl]-1-benzofuran-2-yl]prop-2-ynoate |
| SMILES | COC(=O)C#Cc1cc2ccc(C(=O)N[C@@H]3C[C@H]4CC[C@@H]3N4)cc2o1 |
| InChI | InChI=1S/C19H18N2O4/c1-24-18(22)7-5-14-8-11-2-3-12(9-17(11)25-14)19(23)21-16-10-13-4-6-15(16)20-13/h2-3,8-9,13,15-16,20H,4,6,10H2,1H3,(H,21,23)/t13-,15+,16-/m1/s1 |
| InChIKey | RBABVCUZWWGKAW-VNQPRFMTSA-N |
| XLogP | 1.58 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|