C15H16N2O2S — CID 91358573
N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-sulfanyl-1-benzofuran-5-carboxamide (PubChem CID 91358573) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-sulfanyl-1-benzofuran-5-carboxamide.
| Compound Name | N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-sulfanyl-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 91358573 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-sulfanyl-1-benzofuran-5-carboxamide |
| SMILES | O=C(N[C@@H]1C[C@H]2CC[C@@H]1N2)c1ccc2oc(S)cc2c1 |
| InChI | InChI=1S/C15H16N2O2S/c18-15(17-12-7-10-2-3-11(12)16-10)8-1-4-13-9(5-8)6-14(20)19-13/h1,4-6,10-12,16,20H,2-3,7H2,(H,17,18)/t10-,11+,12-/m1/s1 |
| InChIKey | VRZXWWFNNPQFQY-GRYCIOLGSA-N |
| XLogP | 2.34 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|