C18H19N3O3 — CID 11723831
N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-(aziridine-1-carbonyl)-1-benzofuran-5-carboxamide (PubChem CID 11723831) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-(aziridine-1-carbonyl)-1-benzofuran-5-carboxamide.
| Compound Name | N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-(aziridine-1-carbonyl)-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 11723831 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-(aziridine-1-carbonyl)-1-benzofuran-5-carboxamide |
| SMILES | O=C(N[C@@H]1C[C@H]2CC[C@@H]1N2)c1ccc2oc(C(=O)N3CC3)cc2c1 |
| InChI | InChI=1S/C18H19N3O3/c22-17(20-14-9-12-2-3-13(14)19-12)10-1-4-15-11(7-10)8-16(24-15)18(23)21-5-6-21/h1,4,7-8,12-14,19H,2-3,5-6,9H2,(H,20,22)/t12-,13+,14-/m1/s1 |
| InChIKey | MRXQROJZLMPERL-HZSPNIEDSA-N |
| XLogP | 1.51 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|