C15H15IN2O2 — CID 90847887
N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-3-iodo-1-benzofuran-5-carboxamide (PubChem CID 90847887) has the molecular formula C15H15IN2O2 and a molecular weight of 382.20 g/mol. Its IUPAC name is N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-3-iodo-1-benzofuran-5-carboxamide.
| Compound Name | N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-3-iodo-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 90847887 |
| Molecular Formula | C15H15IN2O2 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-3-iodo-1-benzofuran-5-carboxamide |
| SMILES | O=C(N[C@@H]1C[C@H]2CC[C@@H]1N2)c1ccc2occ(I)c2c1 |
| InChI | InChI=1S/C15H15IN2O2/c16-11-7-20-14-4-1-8(5-10(11)14)15(19)18-13-6-9-2-3-12(13)17-9/h1,4-5,7,9,12-13,17H,2-3,6H2,(H,18,19)/t9-,12+,13-/m1/s1 |
| InChIKey | LQIOSEBFMAHUIG-JIMOISOXSA-N |
| XLogP | 2.66 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|