C17H17NO5 — CID 10171904
(E)-3-(3,4-dihydroxyphenyl)-N-[2-(3,4-dihydroxyphenyl)ethyl]prop-2-enamide (PubChem CID 10171904) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is (E)-3-(3,4-dihydroxyphenyl)-N-[2-(3,4-dihydroxyphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dihydroxyphenyl)-N-[2-(3,4-dihydroxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 10171904 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)-N-[2-(3,4-dihydroxyphenyl)ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H17NO5/c19-13-4-1-11(9-15(13)21)3-6-17(23)18-8-7-12-2-5-14(20)16(22)10-12/h1-6,9-10,19-22H,7-8H2,(H,18,23)/b6-3+ |
| InChIKey | FSMGGLPUXCKRGT-ZZXKWVIFSA-N |
| XLogP | 1.88 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|