C18H22N2O4 — CID 10172057
4,4-dimethyl-3-[3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 10172057) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 4,4-dimethyl-3-[3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | 4,4-dimethyl-3-[3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10172057 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4,4-dimethyl-3-[3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1cc(C)c(C2=NOC(C(=O)N3C(=O)OCC3(C)C)C2)c(C)c1 |
| InChI | InChI=1S/C18H22N2O4/c1-10-6-11(2)15(12(3)7-10)13-8-14(24-19-13)16(21)20-17(22)23-9-18(20,4)5/h6-7,14H,8-9H2,1-5H3 |
| InChIKey | CTZAUAJPMZEJKK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |