C25H25N3O3 — CID 1017311
[4-[4-(1,3-benzodioxol-5-ylmethylamino)phenyl]piperazin-1-yl]-phenylmethanone (PubChem CID 1017311) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is [4-[4-(1,3-benzodioxol-5-ylmethylamino)phenyl]piperazin-1-yl]-phenylmethanone.
| Compound Name | [4-[4-(1,3-benzodioxol-5-ylmethylamino)phenyl]piperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 1017311 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | [4-[4-(1,3-benzodioxol-5-ylmethylamino)phenyl]piperazin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCN(c2ccc(NCc3ccc4c(c3)OCO4)cc2)CC1 |
| InChI | InChI=1S/C25H25N3O3/c29-25(20-4-2-1-3-5-20)28-14-12-27(13-15-28)22-9-7-21(8-10-22)26-17-19-6-11-23-24(16-19)31-18-30-23/h1-11,16,26H,12-15,17-18H2 |
| InChIKey | FTMWZVAKZUMZAU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|