C20H19Cl4N3 — CID 10173626
1,5-bis(2,4-dichlorophenyl)-3-hexyl-1,2,4-triazole (PubChem CID 10173626) has the molecular formula C20H19Cl4N3 and a molecular weight of 443.21 g/mol. Its IUPAC name is 1,5-bis(2,4-dichlorophenyl)-3-hexyl-1,2,4-triazole.
| Compound Name | 1,5-bis(2,4-dichlorophenyl)-3-hexyl-1,2,4-triazole |
|---|---|
| PubChem CID | 10173626 |
| Molecular Formula | C20H19Cl4N3 |
| Molecular Weight | 443.21 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | 1,5-bis(2,4-dichlorophenyl)-3-hexyl-1,2,4-triazole |
| SMILES | CCCCCCc1nc(-c2ccc(Cl)cc2Cl)n(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C20H19Cl4N3/c1-2-3-4-5-6-19-25-20(15-9-7-13(21)11-16(15)23)27(26-19)18-10-8-14(22)12-17(18)24/h7-12H,2-6H2,1H3 |
| InChIKey | ZJEIDYSHVWGVHM-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.21 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|