C15H11Cl2N3S — CID 3063088
1,5-bis(4-chlorophenyl)-3-methylsulfanyl-1,2,4-triazole (PubChem CID 3063088) has the molecular formula C15H11Cl2N3S and a molecular weight of 336.25 g/mol. Its IUPAC name is 1,5-bis(4-chlorophenyl)-3-methylsulfanyl-1,2,4-triazole.
| Compound Name | 1,5-bis(4-chlorophenyl)-3-methylsulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 3063088 |
| Molecular Formula | C15H11Cl2N3S |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 1,5-bis(4-chlorophenyl)-3-methylsulfanyl-1,2,4-triazole |
| SMILES | CSc1nc(-c2ccc(Cl)cc2)n(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C15H11Cl2N3S/c1-21-15-18-14(10-2-4-11(16)5-3-10)20(19-15)13-8-6-12(17)7-9-13/h2-9H,1H3 |
| InChIKey | MSDUUOVVVOVKAY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |