C21H18FIN2O — CID 10173887
N-benzyl-4-fluoro-2-(4-iodo-2-methylanilino)benzamide (PubChem CID 10173887) has the molecular formula C21H18FIN2O and a molecular weight of 460.29 g/mol. Its IUPAC name is N-benzyl-4-fluoro-2-(4-iodo-2-methylanilino)benzamide.
| Compound Name | N-benzyl-4-fluoro-2-(4-iodo-2-methylanilino)benzamide |
|---|---|
| PubChem CID | 10173887 |
| Molecular Formula | C21H18FIN2O |
| Molecular Weight | 460.29 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | N-benzyl-4-fluoro-2-(4-iodo-2-methylanilino)benzamide |
| SMILES | Cc1cc(I)ccc1Nc1cc(F)ccc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H18FIN2O/c1-14-11-17(23)8-10-19(14)25-20-12-16(22)7-9-18(20)21(26)24-13-15-5-3-2-4-6-15/h2-12,25H,13H2,1H3,(H,24,26) |
| InChIKey | PMRYRJFGVUNXAW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.29 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|