C21H27FIN3O2 — CID 22271689
N-[3-(diethylamino)-2-hydroxypropyl]-5-fluoro-2-(4-iodo-2-methylanilino)benzamide (PubChem CID 22271689) has the molecular formula C21H27FIN3O2 and a molecular weight of 499.37 g/mol. Its IUPAC name is N-[3-(diethylamino)-2-hydroxypropyl]-5-fluoro-2-(4-iodo-2-methylanilino)benzamide.
| Compound Name | N-[3-(diethylamino)-2-hydroxypropyl]-5-fluoro-2-(4-iodo-2-methylanilino)benzamide |
|---|---|
| PubChem CID | 22271689 |
| Molecular Formula | C21H27FIN3O2 |
| Molecular Weight | 499.37 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | N-[3-(diethylamino)-2-hydroxypropyl]-5-fluoro-2-(4-iodo-2-methylanilino)benzamide |
| SMILES | CCN(CC)CC(O)CNC(=O)c1cc(F)ccc1Nc1ccc(I)cc1C |
| InChI | InChI=1S/C21H27FIN3O2/c1-4-26(5-2)13-17(27)12-24-21(28)18-11-15(22)6-8-20(18)25-19-9-7-16(23)10-14(19)3/h6-11,17,25,27H,4-5,12-13H2,1-3H3,(H,24,28) |
| InChIKey | XQLIVOYIWQHNST-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|