C20H25BrIN3O — CID 22226090
5-bromo-N-[2-(diethylamino)ethyl]-2-(4-iodo-2-methylanilino)benzamide (PubChem CID 22226090) has the molecular formula C20H25BrIN3O and a molecular weight of 530.25 g/mol. Its IUPAC name is 5-bromo-N-[2-(diethylamino)ethyl]-2-(4-iodo-2-methylanilino)benzamide.
| Compound Name | 5-bromo-N-[2-(diethylamino)ethyl]-2-(4-iodo-2-methylanilino)benzamide |
|---|---|
| PubChem CID | 22226090 |
| Molecular Formula | C20H25BrIN3O |
| Molecular Weight | 530.25 g/mol |
| Exact Mass | 529.02 |
| IUPAC Name | 5-bromo-N-[2-(diethylamino)ethyl]-2-(4-iodo-2-methylanilino)benzamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(Br)ccc1Nc1ccc(I)cc1C |
| InChI | InChI=1S/C20H25BrIN3O/c1-4-25(5-2)11-10-23-20(26)17-13-15(21)6-8-19(17)24-18-9-7-16(22)12-14(18)3/h6-9,12-13,24H,4-5,10-11H2,1-3H3,(H,23,26) |
| InChIKey | AZVJODFNVSECTP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.25 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|