C23H25ClN6OS — CID 10174019
5-[1-[2-aminoethyl-[(6-chloro-3-pyridinyl)methyl]amino]propyl]-6-benzyl-[1,3]thiazolo[5,4-d]pyrimidin-7-one (PubChem CID 10174019) has the molecular formula C23H25ClN6OS and a molecular weight of 469.01 g/mol. Its IUPAC name is 5-[1-[2-aminoethyl-[(6-chloro-3-pyridinyl)methyl]amino]propyl]-6-benzyl-[1,3]thiazolo[5,4-d]pyrimidin-7-one.
| Compound Name | 5-[1-[2-aminoethyl-[(6-chloro-3-pyridinyl)methyl]amino]propyl]-6-benzyl-[1,3]thiazolo[5,4-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 10174019 |
| Molecular Formula | C23H25ClN6OS |
| Molecular Weight | 469.01 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 5-[1-[2-aminoethyl-[(6-chloro-3-pyridinyl)methyl]amino]propyl]-6-benzyl-[1,3]thiazolo[5,4-d]pyrimidin-7-one |
| SMILES | CCC(c1nc2scnc2c(=O)n1Cc1ccccc1)N(CCN)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C23H25ClN6OS/c1-2-18(29(11-10-25)13-17-8-9-19(24)26-12-17)21-28-22-20(27-15-32-22)23(31)30(21)14-16-6-4-3-5-7-16/h3-9,12,15,18H,2,10-11,13-14,25H2,1H3 |
| InChIKey | HZYUXPIFILHURP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.01 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|