C25H25ClN6O3 — CID 11755427
N-(2-aminoethyl)-N-[1-(3-benzyl-7-chloro-4-oxopyrido[2,3-d]pyrimidin-2-yl)propyl]-1-oxidopyridin-1-ium-4-carboxamide (PubChem CID 11755427) has the molecular formula C25H25ClN6O3 and a molecular weight of 492.97 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-[1-(3-benzyl-7-chloro-4-oxopyrido[2,3-d]pyrimidin-2-yl)propyl]-1-oxidopyridin-1-ium-4-carboxamide.
| Compound Name | N-(2-aminoethyl)-N-[1-(3-benzyl-7-chloro-4-oxopyrido[2,3-d]pyrimidin-2-yl)propyl]-1-oxidopyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 11755427 |
| Molecular Formula | C25H25ClN6O3 |
| Molecular Weight | 492.97 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | N-(2-aminoethyl)-N-[1-(3-benzyl-7-chloro-4-oxopyrido[2,3-d]pyrimidin-2-yl)propyl]-1-oxidopyridin-1-ium-4-carboxamide |
| SMILES | CCC(c1nc2nc(Cl)ccc2c(=O)n1Cc1ccccc1)N(CCN)C(=O)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C25H25ClN6O3/c1-2-20(31(15-12-27)24(33)18-10-13-30(35)14-11-18)23-29-22-19(8-9-21(26)28-22)25(34)32(23)16-17-6-4-3-5-7-17/h3-11,13-14,20H,2,12,15-16,27H2,1H3 |
| InChIKey | USMKTPHJZRWVKN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.97 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|