C26H25N5O3 — CID 10389294
N-[1-(3-benzyl-4-oxopyrido[2,3-d]pyrimidin-2-yl)propyl]-N-cyclopropyl-1-oxidopyridin-1-ium-4-carboxamide (PubChem CID 10389294) has the molecular formula C26H25N5O3 and a molecular weight of 455.52 g/mol. Its IUPAC name is N-[1-(3-benzyl-4-oxopyrido[2,3-d]pyrimidin-2-yl)propyl]-N-cyclopropyl-1-oxidopyridin-1-ium-4-carboxamide.
| Compound Name | N-[1-(3-benzyl-4-oxopyrido[2,3-d]pyrimidin-2-yl)propyl]-N-cyclopropyl-1-oxidopyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 10389294 |
| Molecular Formula | C26H25N5O3 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | N-[1-(3-benzyl-4-oxopyrido[2,3-d]pyrimidin-2-yl)propyl]-N-cyclopropyl-1-oxidopyridin-1-ium-4-carboxamide |
| SMILES | CCC(c1nc2ncccc2c(=O)n1Cc1ccccc1)N(C(=O)c1cc[n+]([O-])cc1)C1CC1 |
| InChI | InChI=1S/C26H25N5O3/c1-2-22(31(20-10-11-20)25(32)19-12-15-29(34)16-13-19)24-28-23-21(9-6-14-27-23)26(33)30(24)17-18-7-4-3-5-8-18/h3-9,12-16,20,22H,2,10-11,17H2,1H3 |
| InChIKey | XPWXTXNXNGAUSN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|