C27H29ClN6O3 — CID 10436721
N-[1-(3-benzyl-7-chloro-4-oxopyrido[2,3-d]pyrimidin-2-yl)propyl]-N-[2-(dimethylamino)ethyl]-1-oxidopyridin-1-ium-4-carboxamide (PubChem CID 10436721) has the molecular formula C27H29ClN6O3 and a molecular weight of 521.02 g/mol. Its IUPAC name is N-[1-(3-benzyl-7-chloro-4-oxopyrido[2,3-d]pyrimidin-2-yl)propyl]-N-[2-(dimethylamino)ethyl]-1-oxidopyridin-1-ium-4-carboxamide.
| Compound Name | N-[1-(3-benzyl-7-chloro-4-oxopyrido[2,3-d]pyrimidin-2-yl)propyl]-N-[2-(dimethylamino)ethyl]-1-oxidopyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 10436721 |
| Molecular Formula | C27H29ClN6O3 |
| Molecular Weight | 521.02 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | N-[1-(3-benzyl-7-chloro-4-oxopyrido[2,3-d]pyrimidin-2-yl)propyl]-N-[2-(dimethylamino)ethyl]-1-oxidopyridin-1-ium-4-carboxamide |
| SMILES | CCC(c1nc2nc(Cl)ccc2c(=O)n1Cc1ccccc1)N(CCN(C)C)C(=O)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C27H29ClN6O3/c1-4-22(33(17-16-31(2)3)26(35)20-12-14-32(37)15-13-20)25-30-24-21(10-11-23(28)29-24)27(36)34(25)18-19-8-6-5-7-9-19/h5-15,22H,4,16-18H2,1-3H3 |
| InChIKey | AYCLWFITBIBORB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 98.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.02 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|