C22H24N6O4S — CID 118421545
N-[2-(methylamino)ethyl]-1-oxido-N-[1-[4-oxo-3-(1,3-thiazol-5-ylmethyl)furo[2,3-d]pyrimidin-2-yl]propyl]pyridin-1-ium-4-carboxamide (PubChem CID 118421545) has the molecular formula C22H24N6O4S and a molecular weight of 468.54 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-1-oxido-N-[1-[4-oxo-3-(1,3-thiazol-5-ylmethyl)furo[2,3-d]pyrimidin-2-yl]propyl]pyridin-1-ium-4-carboxamide.
| Compound Name | N-[2-(methylamino)ethyl]-1-oxido-N-[1-[4-oxo-3-(1,3-thiazol-5-ylmethyl)furo[2,3-d]pyrimidin-2-yl]propyl]pyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 118421545 |
| Molecular Formula | C22H24N6O4S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | N-[2-(methylamino)ethyl]-1-oxido-N-[1-[4-oxo-3-(1,3-thiazol-5-ylmethyl)furo[2,3-d]pyrimidin-2-yl]propyl]pyridin-1-ium-4-carboxamide |
| SMILES | CCC(c1nc2occc2c(=O)n1Cc1cncs1)N(CCNC)C(=O)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C22H24N6O4S/c1-3-18(27(10-7-23-2)21(29)15-4-8-26(31)9-5-15)19-25-20-17(6-11-32-20)22(30)28(19)13-16-12-24-14-33-16/h4-6,8-9,11-12,14,18,23H,3,7,10,13H2,1-2H3 |
| InChIKey | JXYRXONBYPQQIL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 120.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|