C28H29N5O3 — CID 10345199
N-[1-(3-benzyl-4-oxopyrido[2,3-d]pyrimidin-2-yl)propyl]-N-(2-cyclopropylethyl)-1-oxidopyridin-1-ium-4-carboxamide (PubChem CID 10345199) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is N-[1-(3-benzyl-4-oxopyrido[2,3-d]pyrimidin-2-yl)propyl]-N-(2-cyclopropylethyl)-1-oxidopyridin-1-ium-4-carboxamide.
| Compound Name | N-[1-(3-benzyl-4-oxopyrido[2,3-d]pyrimidin-2-yl)propyl]-N-(2-cyclopropylethyl)-1-oxidopyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 10345199 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | N-[1-(3-benzyl-4-oxopyrido[2,3-d]pyrimidin-2-yl)propyl]-N-(2-cyclopropylethyl)-1-oxidopyridin-1-ium-4-carboxamide |
| SMILES | CCC(c1nc2ncccc2c(=O)n1Cc1ccccc1)N(CCC1CC1)C(=O)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C28H29N5O3/c1-2-24(32(18-12-20-10-11-20)27(34)22-13-16-31(36)17-14-22)26-30-25-23(9-6-15-29-25)28(35)33(26)19-21-7-4-3-5-8-21/h3-9,13-17,20,24H,2,10-12,18-19H2,1H3 |
| InChIKey | TZAZICWUMXYNDN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|