C20H16F3NO3 — CID 10177458
3-acetyl-4-hydroxy-2-phenyl-1-[[4-(trifluoromethyl)phenyl]methyl]-2H-pyrrol-5-one (PubChem CID 10177458) has the molecular formula C20H16F3NO3 and a molecular weight of 375.35 g/mol. Its IUPAC name is 3-acetyl-4-hydroxy-2-phenyl-1-[[4-(trifluoromethyl)phenyl]methyl]-2H-pyrrol-5-one.
| Compound Name | 3-acetyl-4-hydroxy-2-phenyl-1-[[4-(trifluoromethyl)phenyl]methyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 10177458 |
| Molecular Formula | C20H16F3NO3 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 3-acetyl-4-hydroxy-2-phenyl-1-[[4-(trifluoromethyl)phenyl]methyl]-2H-pyrrol-5-one |
| SMILES | CC(=O)C1=C(O)C(=O)N(Cc2ccc(C(F)(F)F)cc2)C1c1ccccc1 |
| InChI | InChI=1S/C20H16F3NO3/c1-12(25)16-17(14-5-3-2-4-6-14)24(19(27)18(16)26)11-13-7-9-15(10-8-13)20(21,22)23/h2-10,17,26H,11H2,1H3 |
| InChIKey | SUGPYYORMJPZKT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |