C20H16INO3 — CID 1017781
2,3-dihydroindol-1-yl-[5-[(4-iodophenoxy)methyl]furan-2-yl]methanone (PubChem CID 1017781) has the molecular formula C20H16INO3 and a molecular weight of 445.26 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-[5-[(4-iodophenoxy)methyl]furan-2-yl]methanone.
| Compound Name | 2,3-dihydroindol-1-yl-[5-[(4-iodophenoxy)methyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 1017781 |
| Molecular Formula | C20H16INO3 |
| Molecular Weight | 445.26 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 2,3-dihydroindol-1-yl-[5-[(4-iodophenoxy)methyl]furan-2-yl]methanone |
| SMILES | O=C(c1ccc(COc2ccc(I)cc2)o1)N1CCc2ccccc21 |
| InChI | InChI=1S/C20H16INO3/c21-15-5-7-16(8-6-15)24-13-17-9-10-19(25-17)20(23)22-12-11-14-3-1-2-4-18(14)22/h1-10H,11-13H2 |
| InChIKey | NARMTRYGNKFSNQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.26 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|