C20H18N2O3 — CID 91679646
[5-(2-amino-4-methoxyphenyl)furan-2-yl]-(2,3-dihydroindol-1-yl)methanone (PubChem CID 91679646) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is [5-(2-amino-4-methoxyphenyl)furan-2-yl]-(2,3-dihydroindol-1-yl)methanone.
| Compound Name | [5-(2-amino-4-methoxyphenyl)furan-2-yl]-(2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 91679646 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | [5-(2-amino-4-methoxyphenyl)furan-2-yl]-(2,3-dihydroindol-1-yl)methanone |
| SMILES | COc1ccc(-c2ccc(C(=O)N3CCc4ccccc43)o2)c(N)c1 |
| InChI | InChI=1S/C20H18N2O3/c1-24-14-6-7-15(16(21)12-14)18-8-9-19(25-18)20(23)22-11-10-13-4-2-3-5-17(13)22/h2-9,12H,10-11,21H2,1H3 |
| InChIKey | IREHXEDNXIOVIY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|