C23H19N3O4 — CID 10179162
methyl (10R)-10-(1,3-benzodioxol-5-yl)-12-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,14-hexaene-14-carboxylate (PubChem CID 10179162) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is methyl (10R)-10-(1,3-benzodioxol-5-yl)-12-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,14-hexaene-14-carboxylate.
| Compound Name | methyl (10R)-10-(1,3-benzodioxol-5-yl)-12-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,14-hexaene-14-carboxylate |
|---|---|
| PubChem CID | 10179162 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | methyl (10R)-10-(1,3-benzodioxol-5-yl)-12-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,12,14-hexaene-14-carboxylate |
| SMILES | COC(=O)c1nc(C)n2c1Cc1c([nH]c3ccccc13)[C@H]2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H19N3O4/c1-12-24-21(23(27)28-2)17-10-15-14-5-3-4-6-16(14)25-20(15)22(26(12)17)13-7-8-18-19(9-13)30-11-29-18/h3-9,22,25H,10-11H2,1-2H3/t22-/m1/s1 |
| InChIKey | MNOQPMSKKABAJD-JOCHJYFZSA-N |
| XLogP | 3.73 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|