C22H22N6O4 — CID 10181353
N-(furan-2-ylmethyl)-4-[5-(methoxycarbamoyl)-2-methylanilino]-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide (PubChem CID 10181353) has the molecular formula C22H22N6O4 and a molecular weight of 434.46 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-[5-(methoxycarbamoyl)-2-methylanilino]-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-4-[5-(methoxycarbamoyl)-2-methylanilino]-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
|---|---|
| PubChem CID | 10181353 |
| Molecular Formula | C22H22N6O4 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-[5-(methoxycarbamoyl)-2-methylanilino]-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
| SMILES | CONC(=O)c1ccc(C)c(Nc2ncnn3cc(C(=O)NCc4ccco4)c(C)c23)c1 |
| InChI | InChI=1S/C22H22N6O4/c1-13-6-7-15(21(29)27-31-3)9-18(13)26-20-19-14(2)17(11-28(19)25-12-24-20)22(30)23-10-16-5-4-8-32-16/h4-9,11-12H,10H2,1-3H3,(H,23,30)(H,27,29)(H,24,25,26) |
| InChIKey | IHZAZIFETIWXSV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 122.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|