C19H21N7O3 — CID 143036177
methyl 5-methyl-4-[2-methyl-5-[(Z)-N'-(methylcarbamoyl)carbamimidoyl]anilino]pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate (PubChem CID 143036177) has the molecular formula C19H21N7O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is methyl 5-methyl-4-[2-methyl-5-[(Z)-N'-(methylcarbamoyl)carbamimidoyl]anilino]pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate.
| Compound Name | methyl 5-methyl-4-[2-methyl-5-[(Z)-N'-(methylcarbamoyl)carbamimidoyl]anilino]pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate |
|---|---|
| PubChem CID | 143036177 |
| Molecular Formula | C19H21N7O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | methyl 5-methyl-4-[2-methyl-5-[(Z)-N'-(methylcarbamoyl)carbamimidoyl]anilino]pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate |
| SMILES | CNC(=O)/N=C(\N)c1ccc(C)c(Nc2ncnn3cc(C(=O)OC)c(C)c23)c1 |
| InChI | InChI=1S/C19H21N7O3/c1-10-5-6-12(16(20)25-19(28)21-3)7-14(10)24-17-15-11(2)13(18(27)29-4)8-26(15)23-9-22-17/h5-9H,1-4H3,(H,22,23,24)(H3,20,21,25,28) |
| InChIKey | ATLSADZPJYLZHK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|