C17H20N6O — CID 24755389
4-(5-amino-2-methylanilino)-N-ethyl-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide (PubChem CID 24755389) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is 4-(5-amino-2-methylanilino)-N-ethyl-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide.
| Compound Name | 4-(5-amino-2-methylanilino)-N-ethyl-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
|---|---|
| PubChem CID | 24755389 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 4-(5-amino-2-methylanilino)-N-ethyl-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
| SMILES | CCNC(=O)c1cn2ncnc(Nc3cc(N)ccc3C)c2c1C |
| InChI | InChI=1S/C17H20N6O/c1-4-19-17(24)13-8-23-15(11(13)3)16(20-9-21-23)22-14-7-12(18)6-5-10(14)2/h5-9H,4,18H2,1-3H3,(H,19,24)(H,20,21,22) |
| InChIKey | ILXGPECUYILJET-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|