C23H27F3N6O5 — CID 46938615
N-ethyl-4-[5-(2-methoxyethylcarbamoyl)-2-methylanilino]-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 46938615) has the molecular formula C23H27F3N6O5 and a molecular weight of 524.50 g/mol. Its IUPAC name is N-ethyl-4-[5-(2-methoxyethylcarbamoyl)-2-methylanilino]-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-ethyl-4-[5-(2-methoxyethylcarbamoyl)-2-methylanilino]-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 46938615 |
| Molecular Formula | C23H27F3N6O5 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | N-ethyl-4-[5-(2-methoxyethylcarbamoyl)-2-methylanilino]-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCNC(=O)c1cn2ncnc(Nc3cc(C(=O)NCCOC)ccc3C)c2c1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H26N6O3.C2HF3O2/c1-5-22-21(29)16-11-27-18(14(16)3)19(24-12-25-27)26-17-10-15(7-6-13(17)2)20(28)23-8-9-30-4;3-2(4,5)1(6)7/h6-7,10-12H,5,8-9H2,1-4H3,(H,22,29)(H,23,28)(H,24,25,26);(H,6,7) |
| InChIKey | NXOYCZWTFQJYGY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 146.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|