C19H19F3N6O3 — CID 87853260
N-ethyl-4-[5-[hydroxy(methyl)carbamoyl]-2-methylanilino]-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide (PubChem CID 87853260) has the molecular formula C19H19F3N6O3 and a molecular weight of 436.39 g/mol. Its IUPAC name is N-ethyl-4-[5-[hydroxy(methyl)carbamoyl]-2-methylanilino]-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide.
| Compound Name | N-ethyl-4-[5-[hydroxy(methyl)carbamoyl]-2-methylanilino]-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
|---|---|
| PubChem CID | 87853260 |
| Molecular Formula | C19H19F3N6O3 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-ethyl-4-[5-[hydroxy(methyl)carbamoyl]-2-methylanilino]-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
| SMILES | CCNC(=O)c1cn2ncnc(Nc3cc(C(=O)N(C)O)ccc3C)c2c1C(F)(F)F |
| InChI | InChI=1S/C19H19F3N6O3/c1-4-23-17(29)12-8-28-15(14(12)19(20,21)22)16(24-9-25-28)26-13-7-11(6-5-10(13)2)18(30)27(3)31/h5-9,31H,4H2,1-3H3,(H,23,29)(H,24,25,26) |
| InChIKey | WAWUCRKZQUXSQM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|