C26H31N7O7 — CID 89164654
[ethyl-[3-[[6-(ethylcarbamoyl)-5-methylpyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-4-methylbenzoyl]carbamoyl]oxymethyl 2-formamidopropanoate (PubChem CID 89164654) has the molecular formula C26H31N7O7 and a molecular weight of 553.58 g/mol. Its IUPAC name is [ethyl-[3-[[6-(ethylcarbamoyl)-5-methylpyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-4-methylbenzoyl]carbamoyl]oxymethyl 2-formamidopropanoate.
| Compound Name | [ethyl-[3-[[6-(ethylcarbamoyl)-5-methylpyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-4-methylbenzoyl]carbamoyl]oxymethyl 2-formamidopropanoate |
|---|---|
| PubChem CID | 89164654 |
| Molecular Formula | C26H31N7O7 |
| Molecular Weight | 553.58 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | [ethyl-[3-[[6-(ethylcarbamoyl)-5-methylpyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-4-methylbenzoyl]carbamoyl]oxymethyl 2-formamidopropanoate |
| SMILES | CCNC(=O)c1cn2ncnc(Nc3cc(C(=O)N(CC)C(=O)OCOC(=O)C(C)NC=O)ccc3C)c2c1C |
| InChI | InChI=1S/C26H31N7O7/c1-6-27-23(35)19-11-33-21(16(19)4)22(28-12-30-33)31-20-10-18(9-8-15(20)3)24(36)32(7-2)26(38)40-14-39-25(37)17(5)29-13-34/h8-13,17H,6-7,14H2,1-5H3,(H,27,35)(H,29,34)(H,28,30,31) |
| InChIKey | MZVDQJVGQINILO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 173.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.58 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|