C25H29N3O6 — CID 10184970
(2R)-2-ethoxy-3-[4-[2-(2-morpholin-4-yl-4-oxoquinazolin-3-yl)ethoxy]phenyl]propanoic acid (PubChem CID 10184970) has the molecular formula C25H29N3O6 and a molecular weight of 467.52 g/mol. Its IUPAC name is (2R)-2-ethoxy-3-[4-[2-(2-morpholin-4-yl-4-oxoquinazolin-3-yl)ethoxy]phenyl]propanoic acid.
| Compound Name | (2R)-2-ethoxy-3-[4-[2-(2-morpholin-4-yl-4-oxoquinazolin-3-yl)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 10184970 |
| Molecular Formula | C25H29N3O6 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | (2R)-2-ethoxy-3-[4-[2-(2-morpholin-4-yl-4-oxoquinazolin-3-yl)ethoxy]phenyl]propanoic acid |
| SMILES | CCO[C@H](Cc1ccc(OCCn2c(N3CCOCC3)nc3ccccc3c2=O)cc1)C(=O)O |
| InChI | InChI=1S/C25H29N3O6/c1-2-33-22(24(30)31)17-18-7-9-19(10-8-18)34-16-13-28-23(29)20-5-3-4-6-21(20)26-25(28)27-11-14-32-15-12-27/h3-10,22H,2,11-17H2,1H3,(H,30,31)/t22-/m1/s1 |
| InChIKey | CDFSNNMMMGQKPS-JOCHJYFZSA-N |
| XLogP | 2.34 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |