C29H40N2O5 — CID 10185204
(3S)-4-methyl-1-octyl-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazine-2,5-dione (PubChem CID 10185204) has the molecular formula C29H40N2O5 and a molecular weight of 496.65 g/mol. Its IUPAC name is (3S)-4-methyl-1-octyl-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazine-2,5-dione.
| Compound Name | (3S)-4-methyl-1-octyl-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 10185204 |
| Molecular Formula | C29H40N2O5 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | (3S)-4-methyl-1-octyl-3-[[4-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperazine-2,5-dione |
| SMILES | CCCCCCCCN1CC(=O)N(C)[C@@H](Cc2ccc(-c3cc(OC)c(OC)c(OC)c3)cc2)C1=O |
| InChI | InChI=1S/C29H40N2O5/c1-6-7-8-9-10-11-16-31-20-27(32)30(2)24(29(31)33)17-21-12-14-22(15-13-21)23-18-25(34-3)28(36-5)26(19-23)35-4/h12-15,18-19,24H,6-11,16-17,20H2,1-5H3/t24-/m0/s1 |
| InChIKey | VZKJOGGFHYWYMN-DEOSSOPVSA-N |
| XLogP | 4.95 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|