C25H26Cl2N2O4 — CID 1018607
methyl (4E)-4-[[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-5-oxo-1-[[(2S)-oxolan-2-yl]methyl]pyrrole-3-carboxylate (PubChem CID 1018607) has the molecular formula C25H26Cl2N2O4 and a molecular weight of 489.40 g/mol. Its IUPAC name is methyl (4E)-4-[[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-5-oxo-1-[[(2S)-oxolan-2-yl]methyl]pyrrole-3-carboxylate.
| Compound Name | methyl (4E)-4-[[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-5-oxo-1-[[(2S)-oxolan-2-yl]methyl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 1018607 |
| Molecular Formula | C25H26Cl2N2O4 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | methyl (4E)-4-[[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-5-oxo-1-[[(2S)-oxolan-2-yl]methyl]pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(C[C@@H]2CCCO2)C(=O)/C1=C/c1cc(C)n(-c2ccc(Cl)cc2Cl)c1C |
| InChI | InChI=1S/C25H26Cl2N2O4/c1-14-10-17(15(2)29(14)22-8-7-18(26)12-21(22)27)11-20-23(25(31)32-4)16(3)28(24(20)30)13-19-6-5-9-33-19/h7-8,10-12,19H,5-6,9,13H2,1-4H3/b20-11+/t19-/m0/s1 |
| InChIKey | YSQJJVGWXAHNLQ-ATASCALFSA-N |
| XLogP | 5.25 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|